C21H32O6Si — CID 10938441
(1S,4S,5R,6S,9S,12S)-12-[tert-butyl(dimethyl)silyl]oxy-5,6-dihydroxy-7-methyl-4-prop-1-en-2-yl-10-oxatricyclo[7.2.1.01,6]dodec-7-ene-2,11-dione (PubChem CID 10938441) has the molecular formula C21H32O6Si and a molecular weight of 408.57 g/mol. Its IUPAC name is (1S,4S,5R,6S,9S,12S)-12-[tert-butyl(dimethyl)silyl]oxy-5,6-dihydroxy-7-methyl-4-prop-1-en-2-yl-10-oxatricyclo[7.2.1.01,6]dodec-7-ene-2,11-dione.
| Compound Name | (1S,4S,5R,6S,9S,12S)-12-[tert-butyl(dimethyl)silyl]oxy-5,6-dihydroxy-7-methyl-4-prop-1-en-2-yl-10-oxatricyclo[7.2.1.01,6]dodec-7-ene-2,11-dione |
|---|---|
| PubChem CID | 10938441 |
| Molecular Formula | C21H32O6Si |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (1S,4S,5R,6S,9S,12S)-12-[tert-butyl(dimethyl)silyl]oxy-5,6-dihydroxy-7-methyl-4-prop-1-en-2-yl-10-oxatricyclo[7.2.1.01,6]dodec-7-ene-2,11-dione |
| SMILES | C=C(C)[C@@H]1CC(=O)[C@@]23C(=O)O[C@@H](C=C(C)[C@@]2(O)[C@@H]1O)[C@H]3O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H32O6Si/c1-11(2)13-10-15(22)20-17(27-28(7,8)19(4,5)6)14(26-18(20)24)9-12(3)21(20,25)16(13)23/h9,13-14,16-17,23,25H,1,10H2,2-8H3/t13-,14-,16+,17+,20+,21+/m0/s1 |
| InChIKey | QYZGLUOAGMWQLT-KAXRAKRGSA-N |
| XLogP | 2.51 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|