C22H38O5Si — CID 154709460
(1S,2S,4E,6R,7R,8S,9R)-2-hydroxy-6-methoxy-4,11,11-trimethyl-7-triethylsilyloxy-12-oxatricyclo[6.3.2.01,9]tridec-4-en-13-one (PubChem CID 154709460) has the molecular formula C22H38O5Si and a molecular weight of 410.63 g/mol. Its IUPAC name is (1S,2S,4E,6R,7R,8S,9R)-2-hydroxy-6-methoxy-4,11,11-trimethyl-7-triethylsilyloxy-12-oxatricyclo[6.3.2.01,9]tridec-4-en-13-one.
| Compound Name | (1S,2S,4E,6R,7R,8S,9R)-2-hydroxy-6-methoxy-4,11,11-trimethyl-7-triethylsilyloxy-12-oxatricyclo[6.3.2.01,9]tridec-4-en-13-one |
|---|---|
| PubChem CID | 154709460 |
| Molecular Formula | C22H38O5Si |
| Molecular Weight | 410.63 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | (1S,2S,4E,6R,7R,8S,9R)-2-hydroxy-6-methoxy-4,11,11-trimethyl-7-triethylsilyloxy-12-oxatricyclo[6.3.2.01,9]tridec-4-en-13-one |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@H]2C(=O)O[C@]3([C@@H]2CC3(C)C)[C@@H](O)C/C(C)=C\[C@H]1OC |
| InChI | InChI=1S/C22H38O5Si/c1-8-28(9-2,10-3)27-19-16(25-7)11-14(4)12-17(23)22-15(13-21(22,5)6)18(19)20(24)26-22/h11,15-19,23H,8-10,12-13H2,1-7H3/b14-11-/t15-,16-,17+,18+,19+,22-/m1/s1 |
| InChIKey | QJMQOPLSJLQLRN-LQTLMDPWSA-N |
| XLogP | 4.06 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.63 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|