C21H34N6O2 — CID 109384962
1-[3-[[[ethylamino-[methyl(oxolan-3-ylmethyl)amino]methylidene]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide (PubChem CID 109384962) has the molecular formula C21H34N6O2 and a molecular weight of 402.54 g/mol. Its IUPAC name is 1-[3-[[[ethylamino-[methyl(oxolan-3-ylmethyl)amino]methylidene]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide.
| Compound Name | 1-[3-[[[ethylamino-[methyl(oxolan-3-ylmethyl)amino]methylidene]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 109384962 |
| Molecular Formula | C21H34N6O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.27 |
| IUPAC Name | 1-[3-[[[ethylamino-[methyl(oxolan-3-ylmethyl)amino]methylidene]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide |
| SMILES | CCN/C(=N\Cc1cccnc1N1CCCC(C(N)=O)C1)N(C)CC1CCOC1 |
| InChI | InChI=1S/C21H34N6O2/c1-3-23-21(26(2)13-16-8-11-29-15-16)25-12-17-6-4-9-24-20(17)27-10-5-7-18(14-27)19(22)28/h4,6,9,16,18H,3,5,7-8,10-15H2,1-2H3,(H2,22,28)(H,23,25) |
| InChIKey | SCLVTBLDYBOHJP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 96.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|