C23H38N6O — CID 109483943
1-[3-[[[ethylamino-[hept-6-enyl(methyl)amino]methylidene]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide (PubChem CID 109483943) has the molecular formula C23H38N6O and a molecular weight of 414.60 g/mol. Its IUPAC name is 1-[3-[[[ethylamino-[hept-6-enyl(methyl)amino]methylidene]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide.
| Compound Name | 1-[3-[[[ethylamino-[hept-6-enyl(methyl)amino]methylidene]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 109483943 |
| Molecular Formula | C23H38N6O |
| Molecular Weight | 414.60 g/mol |
| Exact Mass | 414.31 |
| IUPAC Name | 1-[3-[[[ethylamino-[hept-6-enyl(methyl)amino]methylidene]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide |
| SMILES | C=CCCCCCN(C)/C(=N/Cc1cccnc1N1CCCC(C(N)=O)C1)NCC |
| InChI | InChI=1S/C23H38N6O/c1-4-6-7-8-9-15-28(3)23(25-5-2)27-17-19-12-10-14-26-22(19)29-16-11-13-20(18-29)21(24)30/h4,10,12,14,20H,1,5-9,11,13,15-18H2,2-3H3,(H2,24,30)(H,25,27) |
| InChIKey | QRDUBTQUTNUKBJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.60 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|