C20H38N4O4 — CID 109391916
methyl 1-[N-ethyl-N'-[2-[(2-methylpropan-2-yl)oxycarbonyl-propylamino]ethyl]carbamimidoyl]piperidine-4-carboxylate (PubChem CID 109391916) has the molecular formula C20H38N4O4 and a molecular weight of 398.55 g/mol. Its IUPAC name is methyl 1-[N-ethyl-N'-[2-[(2-methylpropan-2-yl)oxycarbonyl-propylamino]ethyl]carbamimidoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[N-ethyl-N'-[2-[(2-methylpropan-2-yl)oxycarbonyl-propylamino]ethyl]carbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 109391916 |
| Molecular Formula | C20H38N4O4 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | methyl 1-[N-ethyl-N'-[2-[(2-methylpropan-2-yl)oxycarbonyl-propylamino]ethyl]carbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCCN(CC/N=C(\NCC)N1CCC(C(=O)OC)CC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H38N4O4/c1-7-12-24(19(26)28-20(3,4)5)15-11-22-18(21-8-2)23-13-9-16(10-14-23)17(25)27-6/h16H,7-15H2,1-6H3,(H,21,22) |
| InChIKey | KHFJGCCRFFGDIF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|