C18H27N7O2 — CID 109433181
N-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide (PubChem CID 109433181) has the molecular formula C18H27N7O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is N-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide.
| Compound Name | N-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109433181 |
| Molecular Formula | C18H27N7O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | N-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ncc(C(C)(C)C)o1)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C18H27N7O2/c1-18(2,3)14-9-20-15(27-14)10-21-17(19-4)24-6-7-25(16(26)12-24)13-8-22-23(5)11-13/h8-9,11H,6-7,10,12H2,1-5H3,(H,19,21) |
| InChIKey | GZHZDUIVWUAFCO-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 91.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|