C22H29N7O — CID 109435217
N-ethyl-N'-[2-(4-methyl-1H-indol-3-yl)ethyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide (PubChem CID 109435217) has the molecular formula C22H29N7O and a molecular weight of 407.52 g/mol. Its IUPAC name is N-ethyl-N'-[2-(4-methyl-1H-indol-3-yl)ethyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(4-methyl-1H-indol-3-yl)ethyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109435217 |
| Molecular Formula | C22H29N7O |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | N-ethyl-N'-[2-(4-methyl-1H-indol-3-yl)ethyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1c[nH]c2cccc(C)c12)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C22H29N7O/c1-4-23-22(24-9-8-17-12-25-19-7-5-6-16(2)21(17)19)28-10-11-29(20(30)15-28)18-13-26-27(3)14-18/h5-7,12-14,25H,4,8-11,15H2,1-3H3,(H,23,24) |
| InChIKey | LOPBVVPUZBGYIB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 81.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|