C21H27FN6O — CID 109436109
N-ethyl-N'-[[1-(2-fluorophenyl)cyclopropyl]methyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide (PubChem CID 109436109) has the molecular formula C21H27FN6O and a molecular weight of 398.49 g/mol. Its IUPAC name is N-ethyl-N'-[[1-(2-fluorophenyl)cyclopropyl]methyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[[1-(2-fluorophenyl)cyclopropyl]methyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109436109 |
| Molecular Formula | C21H27FN6O |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | N-ethyl-N'-[[1-(2-fluorophenyl)cyclopropyl]methyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1(c2ccccc2F)CC1)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C21H27FN6O/c1-3-23-20(24-15-21(8-9-21)17-6-4-5-7-18(17)22)27-10-11-28(19(29)14-27)16-12-25-26(2)13-16/h4-7,12-13H,3,8-11,14-15H2,1-2H3,(H,23,24) |
| InChIKey | XNSKHXOVYOXRJS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|