C16H26N6O2 — CID 109433491
N-ethyl-N'-[[1-(hydroxymethyl)cyclopropyl]methyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide (PubChem CID 109433491) has the molecular formula C16H26N6O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-ethyl-N'-[[1-(hydroxymethyl)cyclopropyl]methyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[[1-(hydroxymethyl)cyclopropyl]methyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109433491 |
| Molecular Formula | C16H26N6O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | N-ethyl-N'-[[1-(hydroxymethyl)cyclopropyl]methyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1(CO)CC1)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C16H26N6O2/c1-3-17-15(18-11-16(12-23)4-5-16)21-6-7-22(14(24)10-21)13-8-19-20(2)9-13/h8-9,23H,3-7,10-12H2,1-2H3,(H,17,18) |
| InChIKey | GAGVRZNLNXXCFF-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|