C18H32F3N3O3 — CID 109446899
N'-methyl-4-(oxan-2-ylmethoxy)-N-[3-(2,2,2-trifluoroethoxy)propyl]piperidine-1-carboximidamide (PubChem CID 109446899) has the molecular formula C18H32F3N3O3 and a molecular weight of 395.47 g/mol. Its IUPAC name is N'-methyl-4-(oxan-2-ylmethoxy)-N-[3-(2,2,2-trifluoroethoxy)propyl]piperidine-1-carboximidamide.
| Compound Name | N'-methyl-4-(oxan-2-ylmethoxy)-N-[3-(2,2,2-trifluoroethoxy)propyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109446899 |
| Molecular Formula | C18H32F3N3O3 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | N'-methyl-4-(oxan-2-ylmethoxy)-N-[3-(2,2,2-trifluoroethoxy)propyl]piperidine-1-carboximidamide |
| SMILES | C/N=C(\NCCCOCC(F)(F)F)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C18H32F3N3O3/c1-22-17(23-8-4-11-25-14-18(19,20)21)24-9-6-15(7-10-24)27-13-16-5-2-3-12-26-16/h15-16H,2-14H2,1H3,(H,22,23) |
| InChIKey | DQNPEELCEZFNHN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|