C17H31F3IN3O2 — CID 109446990
N-ethyl-4-(oxan-2-ylmethoxy)-N'-(3,3,3-trifluoropropyl)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109446990) has the molecular formula C17H31F3IN3O2 and a molecular weight of 493.35 g/mol. Its IUPAC name is N-ethyl-4-(oxan-2-ylmethoxy)-N'-(3,3,3-trifluoropropyl)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-4-(oxan-2-ylmethoxy)-N'-(3,3,3-trifluoropropyl)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109446990 |
| Molecular Formula | C17H31F3IN3O2 |
| Molecular Weight | 493.35 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | N-ethyl-4-(oxan-2-ylmethoxy)-N'-(3,3,3-trifluoropropyl)piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(F)(F)F)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C17H30F3N3O2.HI/c1-2-21-16(22-9-8-17(18,19)20)23-10-6-14(7-11-23)25-13-15-5-3-4-12-24-15;/h14-15H,2-13H2,1H3,(H,21,22);1H |
| InChIKey | SPNAAFVPILHVSP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|