C16H30FN3O2 — CID 109446643
N-(3-fluoropropyl)-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide (PubChem CID 109446643) has the molecular formula C16H30FN3O2 and a molecular weight of 315.43 g/mol. Its IUPAC name is N-(3-fluoropropyl)-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide.
| Compound Name | N-(3-fluoropropyl)-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109446643 |
| Molecular Formula | C16H30FN3O2 |
| Molecular Weight | 315.43 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | N-(3-fluoropropyl)-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
| SMILES | C/N=C(\NCCCF)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C16H30FN3O2/c1-18-16(19-9-4-8-17)20-10-6-14(7-11-20)22-13-15-5-2-3-12-21-15/h14-15H,2-13H2,1H3,(H,18,19) |
| InChIKey | ZNJYZZTWZQRHQP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|