C16H28F3N3O2 — CID 109447789
N'-methyl-4-(oxan-2-ylmethoxy)-N-(3,3,3-trifluoropropyl)piperidine-1-carboximidamide (PubChem CID 109447789) has the molecular formula C16H28F3N3O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is N'-methyl-4-(oxan-2-ylmethoxy)-N-(3,3,3-trifluoropropyl)piperidine-1-carboximidamide.
| Compound Name | N'-methyl-4-(oxan-2-ylmethoxy)-N-(3,3,3-trifluoropropyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109447789 |
| Molecular Formula | C16H28F3N3O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | N'-methyl-4-(oxan-2-ylmethoxy)-N-(3,3,3-trifluoropropyl)piperidine-1-carboximidamide |
| SMILES | C/N=C(\NCCC(F)(F)F)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C16H28F3N3O2/c1-20-15(21-8-7-16(17,18)19)22-9-5-13(6-10-22)24-12-14-4-2-3-11-23-14/h13-14H,2-12H2,1H3,(H,20,21) |
| InChIKey | XLKCAAZPZRBFLP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|