C20H37F3N4O2 — CID 109447073
N-ethyl-N'-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide (PubChem CID 109447073) has the molecular formula C20H37F3N4O2 and a molecular weight of 422.54 g/mol. Its IUPAC name is N-ethyl-N'-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109447073 |
| Molecular Formula | C20H37F3N4O2 |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | N-ethyl-N'-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCN(C)CC(F)(F)F)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C20H37F3N4O2/c1-3-24-19(25-10-6-11-26(2)16-20(21,22)23)27-12-8-17(9-13-27)29-15-18-7-4-5-14-28-18/h17-18H,3-16H2,1-2H3,(H,24,25) |
| InChIKey | NKMULNKASFBONY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|