C15H30N4O2S2 — CID 109451751
N',2,2,3,3-pentamethyl-N-(2-thiomorpholin-4-ylsulfonylethyl)azetidine-1-carboximidamide (PubChem CID 109451751) has the molecular formula C15H30N4O2S2 and a molecular weight of 362.57 g/mol. Its IUPAC name is N',2,2,3,3-pentamethyl-N-(2-thiomorpholin-4-ylsulfonylethyl)azetidine-1-carboximidamide.
| Compound Name | N',2,2,3,3-pentamethyl-N-(2-thiomorpholin-4-ylsulfonylethyl)azetidine-1-carboximidamide |
|---|---|
| PubChem CID | 109451751 |
| Molecular Formula | C15H30N4O2S2 |
| Molecular Weight | 362.57 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | N',2,2,3,3-pentamethyl-N-(2-thiomorpholin-4-ylsulfonylethyl)azetidine-1-carboximidamide |
| SMILES | C/N=C(\NCCS(=O)(=O)N1CCSCC1)N1CC(C)(C)C1(C)C |
| InChI | InChI=1S/C15H30N4O2S2/c1-14(2)12-19(15(14,3)4)13(16-5)17-6-11-23(20,21)18-7-9-22-10-8-18/h6-12H2,1-5H3,(H,16,17) |
| InChIKey | SISLOLUUDCJDTK-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.57 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|