C16H30N4O3S2 — CID 119155385
N'-methyl-N-(2-thiomorpholin-4-ylsulfonylethyl)-8-oxa-2-azaspiro[4.5]decane-2-carboximidamide (PubChem CID 119155385) has the molecular formula C16H30N4O3S2 and a molecular weight of 390.58 g/mol. Its IUPAC name is N'-methyl-N-(2-thiomorpholin-4-ylsulfonylethyl)-8-oxa-2-azaspiro[4.5]decane-2-carboximidamide.
| Compound Name | N'-methyl-N-(2-thiomorpholin-4-ylsulfonylethyl)-8-oxa-2-azaspiro[4.5]decane-2-carboximidamide |
|---|---|
| PubChem CID | 119155385 |
| Molecular Formula | C16H30N4O3S2 |
| Molecular Weight | 390.58 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | N'-methyl-N-(2-thiomorpholin-4-ylsulfonylethyl)-8-oxa-2-azaspiro[4.5]decane-2-carboximidamide |
| SMILES | C/N=C(\NCCS(=O)(=O)N1CCSCC1)N1CCC2(CCOCC2)C1 |
| InChI | InChI=1S/C16H30N4O3S2/c1-17-15(19-6-2-16(14-19)3-9-23-10-4-16)18-5-13-25(21,22)20-7-11-24-12-8-20/h2-14H2,1H3,(H,17,18) |
| InChIKey | UHNLVGKZXOYPHU-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.58 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|