C12H23N3O3S2 — CID 119319776
1-amino-N-(2-thiomorpholin-4-ylsulfonylethyl)cyclopentane-1-carboxamide (PubChem CID 119319776) has the molecular formula C12H23N3O3S2 and a molecular weight of 321.47 g/mol. Its IUPAC name is 1-amino-N-(2-thiomorpholin-4-ylsulfonylethyl)cyclopentane-1-carboxamide.
| Compound Name | 1-amino-N-(2-thiomorpholin-4-ylsulfonylethyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 119319776 |
| Molecular Formula | C12H23N3O3S2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 1-amino-N-(2-thiomorpholin-4-ylsulfonylethyl)cyclopentane-1-carboxamide |
| SMILES | NC1(C(=O)NCCS(=O)(=O)N2CCSCC2)CCCC1 |
| InChI | InChI=1S/C12H23N3O3S2/c13-12(3-1-2-4-12)11(16)14-5-10-20(17,18)15-6-8-19-9-7-15/h1-10,13H2,(H,14,16) |
| InChIKey | PZILURNPGGWTQH-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |