C15H30IN3S — CID 109452478
N-ethyl-2,2,3,3-tetramethyl-N'-(2-prop-2-enylsulfanylethyl)azetidine-1-carboximidamide;hydroiodide (PubChem CID 109452478) has the molecular formula C15H30IN3S and a molecular weight of 411.40 g/mol. Its IUPAC name is N-ethyl-2,2,3,3-tetramethyl-N'-(2-prop-2-enylsulfanylethyl)azetidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-2,2,3,3-tetramethyl-N'-(2-prop-2-enylsulfanylethyl)azetidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109452478 |
| Molecular Formula | C15H30IN3S |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | N-ethyl-2,2,3,3-tetramethyl-N'-(2-prop-2-enylsulfanylethyl)azetidine-1-carboximidamide;hydroiodide |
| SMILES | C=CCSCC/N=C(\NCC)N1CC(C)(C)C1(C)C.I |
| InChI | InChI=1S/C15H29N3S.HI/c1-7-10-19-11-9-17-13(16-8-2)18-12-14(3,4)15(18,5)6;/h7H,1,8-12H2,2-6H3,(H,16,17);1H |
| InChIKey | XITMSGPLVLKKKB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|