C13H27N3 — CID 109453036
N-butyl-N',2,2,3,3-pentamethylazetidine-1-carboximidamide (PubChem CID 109453036) has the molecular formula C13H27N3 and a molecular weight of 225.38 g/mol. Its IUPAC name is N-butyl-N',2,2,3,3-pentamethylazetidine-1-carboximidamide.
| Compound Name | N-butyl-N',2,2,3,3-pentamethylazetidine-1-carboximidamide |
|---|---|
| PubChem CID | 109453036 |
| Molecular Formula | C13H27N3 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.22 |
| IUPAC Name | N-butyl-N',2,2,3,3-pentamethylazetidine-1-carboximidamide |
| SMILES | CCCCN/C(=N\C)N1CC(C)(C)C1(C)C |
| InChI | InChI=1S/C13H27N3/c1-7-8-9-15-11(14-6)16-10-12(2,3)13(16,4)5/h7-10H2,1-6H3,(H,14,15) |
| InChIKey | VVVCGSDQVWRLBU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|