C19H21NO2 — CID 10946355
(E)-N-[(4R,5R)-4,5-diphenyl-1,3-dioxolan-2-yl]-2-methylpropan-1-imine (PubChem CID 10946355) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is (E)-N-[(4R,5R)-4,5-diphenyl-1,3-dioxolan-2-yl]-2-methylpropan-1-imine.
| Compound Name | (E)-N-[(4R,5R)-4,5-diphenyl-1,3-dioxolan-2-yl]-2-methylpropan-1-imine |
|---|---|
| PubChem CID | 10946355 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | (E)-N-[(4R,5R)-4,5-diphenyl-1,3-dioxolan-2-yl]-2-methylpropan-1-imine |
| SMILES | CC(C)/C=N/C1O[C@H](c2ccccc2)[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C19H21NO2/c1-14(2)13-20-19-21-17(15-9-5-3-6-10-15)18(22-19)16-11-7-4-8-12-16/h3-14,17-19H,1-2H3/b20-13+/t17-,18-/m1/s1 |
| InChIKey | XYGUJTHVWLKODG-WLWPOCPESA-N |
| XLogP | 4.53 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|