C17H27ClIN5O3 — CID 109466977
tert-butyl 3-[[N-[2-[(3-chloro-2-pyridinyl)oxy]ethyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide (PubChem CID 109466977) has the molecular formula C17H27ClIN5O3 and a molecular weight of 511.79 g/mol. Its IUPAC name is tert-butyl 3-[[N-[2-[(3-chloro-2-pyridinyl)oxy]ethyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 3-[[N-[2-[(3-chloro-2-pyridinyl)oxy]ethyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 109466977 |
| Molecular Formula | C17H27ClIN5O3 |
| Molecular Weight | 511.79 g/mol |
| Exact Mass | 511.08 |
| IUPAC Name | tert-butyl 3-[[N-[2-[(3-chloro-2-pyridinyl)oxy]ethyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide |
| SMILES | C/N=C(\NCCOc1ncccc1Cl)NC1CN(C(=O)OC(C)(C)C)C1.I |
| InChI | InChI=1S/C17H26ClN5O3.HI/c1-17(2,3)26-16(24)23-10-12(11-23)22-15(19-4)21-8-9-25-14-13(18)6-5-7-20-14;/h5-7,12H,8-11H2,1-4H3,(H2,19,21,22);1H |
| InChIKey | FGDGYHHIKUUHRY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.79 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|