C18H30IN3 — CID 109467637
N-[2-(4-tert-butylphenyl)-2-methylpropyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide (PubChem CID 109467637) has the molecular formula C18H30IN3 and a molecular weight of 415.36 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenyl)-2-methylpropyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide.
| Compound Name | N-[2-(4-tert-butylphenyl)-2-methylpropyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
|---|---|
| PubChem CID | 109467637 |
| Molecular Formula | C18H30IN3 |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | N-[2-(4-tert-butylphenyl)-2-methylpropyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
| SMILES | CC(C)(C)c1ccc(C(C)(C)CNC2=NCCCN2)cc1.I |
| InChI | InChI=1S/C18H29N3.HI/c1-17(2,3)14-7-9-15(10-8-14)18(4,5)13-21-16-19-11-6-12-20-16;/h7-10H,6,11-13H2,1-5H3,(H2,19,20,21);1H |
| InChIKey | ANERGHIKLXSVGK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|