C12H22F6N4 — CID 109471291
1-ethyl-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109471291) has the molecular formula C12H22F6N4 and a molecular weight of 336.32 g/mol. Its IUPAC name is 1-ethyl-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-ethyl-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109471291 |
| Molecular Formula | C12H22F6N4 |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 1-ethyl-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCN/C(=N\CCCN(C)CC(F)(F)F)NCCC(F)(F)F |
| InChI | InChI=1S/C12H22F6N4/c1-3-19-10(21-7-5-11(13,14)15)20-6-4-8-22(2)9-12(16,17)18/h3-9H2,1-2H3,(H2,19,20,21) |
| InChIKey | YPOSGZWIEWGCCW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|