C11H21F3IN3O2 — CID 109472380
ethyl 4-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]butanoate;hydroiodide (PubChem CID 109472380) has the molecular formula C11H21F3IN3O2 and a molecular weight of 411.21 g/mol. Its IUPAC name is ethyl 4-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]butanoate;hydroiodide.
| Compound Name | ethyl 4-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]butanoate;hydroiodide |
|---|---|
| PubChem CID | 109472380 |
| Molecular Formula | C11H21F3IN3O2 |
| Molecular Weight | 411.21 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | ethyl 4-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]butanoate;hydroiodide |
| SMILES | CCOC(=O)CCCN/C(=N\C)NCCC(F)(F)F.I |
| InChI | InChI=1S/C11H20F3N3O2.HI/c1-3-19-9(18)5-4-7-16-10(15-2)17-8-6-11(12,13)14;/h3-8H2,1-2H3,(H2,15,16,17);1H |
| InChIKey | HKAOFXMLTAMAMD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|