C18H27N5S — CID 109487695
N',2,2-trimethyl-N-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)ethyl]thiomorpholine-4-carboximidamide (PubChem CID 109487695) has the molecular formula C18H27N5S and a molecular weight of 345.52 g/mol. Its IUPAC name is N',2,2-trimethyl-N-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)ethyl]thiomorpholine-4-carboximidamide.
| Compound Name | N',2,2-trimethyl-N-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)ethyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109487695 |
| Molecular Formula | C18H27N5S |
| Molecular Weight | 345.52 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | N',2,2-trimethyl-N-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)ethyl]thiomorpholine-4-carboximidamide |
| SMILES | C/N=C(/NCCc1cn2cccc(C)c2n1)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C18H27N5S/c1-14-6-5-9-22-12-15(21-16(14)22)7-8-20-17(19-4)23-10-11-24-18(2,3)13-23/h5-6,9,12H,7-8,10-11,13H2,1-4H3,(H,19,20) |
| InChIKey | XBUFULSMUNEFJK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 44.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.52 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|