C17H31N5S — CID 109489375
N-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide (PubChem CID 109489375) has the molecular formula C17H31N5S and a molecular weight of 337.54 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide.
| Compound Name | N-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109489375 |
| Molecular Formula | C17H31N5S |
| Molecular Weight | 337.54 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | N-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide |
| SMILES | C/N=C(\NCC(C)Cn1nc(C)cc1C)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C17H31N5S/c1-13(11-22-15(3)9-14(2)20-22)10-19-16(18-6)21-7-8-23-17(4,5)12-21/h9,13H,7-8,10-12H2,1-6H3,(H,18,19) |
| InChIKey | XKYZXWNHADHFOJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.54 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|