C12H23IN6S — CID 109489924
N',2,2-trimethyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109489924) has the molecular formula C12H23IN6S and a molecular weight of 410.33 g/mol. Its IUPAC name is N',2,2-trimethyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N',2,2-trimethyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109489924 |
| Molecular Formula | C12H23IN6S |
| Molecular Weight | 410.33 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | N',2,2-trimethyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1nncn1C)N1CCSC(C)(C)C1.I |
| InChI | InChI=1S/C12H22N6S.HI/c1-12(2)8-18(5-6-19-12)11(13-3)14-7-10-16-15-9-17(10)4;/h9H,5-8H2,1-4H3,(H,13,14);1H |
| InChIKey | WGVVYPQDKLRJFQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|