C16H28N4S2 — CID 109487689
N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide (PubChem CID 109487689) has the molecular formula C16H28N4S2 and a molecular weight of 340.56 g/mol. Its IUPAC name is N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide.
| Compound Name | N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109487689 |
| Molecular Formula | C16H28N4S2 |
| Molecular Weight | 340.56 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | N-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide |
| SMILES | C/N=C(\NCc1nc(C(C)(C)C)cs1)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C16H28N4S2/c1-15(2,3)12-10-21-13(19-12)9-18-14(17-6)20-7-8-22-16(4,5)11-20/h10H,7-9,11H2,1-6H3,(H,17,18) |
| InChIKey | SBBFOFOCUBCMOH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.56 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|