C23H30N2OS — CID 10948965
7-anilino-2-methyl-4-octan-2-yl-1,4-benzothiazin-3-one (PubChem CID 10948965) has the molecular formula C23H30N2OS and a molecular weight of 382.57 g/mol. Its IUPAC name is 7-anilino-2-methyl-4-octan-2-yl-1,4-benzothiazin-3-one.
| Compound Name | 7-anilino-2-methyl-4-octan-2-yl-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 10948965 |
| Molecular Formula | C23H30N2OS |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 7-anilino-2-methyl-4-octan-2-yl-1,4-benzothiazin-3-one |
| SMILES | CCCCCCC(C)N1C(=O)C(C)Sc2cc(Nc3ccccc3)ccc21 |
| InChI | InChI=1S/C23H30N2OS/c1-4-5-6-8-11-17(2)25-21-15-14-20(24-19-12-9-7-10-13-19)16-22(21)27-18(3)23(25)26/h7,9-10,12-18,24H,4-6,8,11H2,1-3H3 |
| InChIKey | MQEJCINMXNSSCI-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|