C14H30IN3 — CID 109490126
N',3-dimethyl-N,3-dipropylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 109490126) has the molecular formula C14H30IN3 and a molecular weight of 367.32 g/mol. Its IUPAC name is N',3-dimethyl-N,3-dipropylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N',3-dimethyl-N,3-dipropylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109490126 |
| Molecular Formula | C14H30IN3 |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | N',3-dimethyl-N,3-dipropylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCCN/C(=N\C)N1CCCC(C)(CCC)C1.I |
| InChI | InChI=1S/C14H29N3.HI/c1-5-8-14(3)9-7-11-17(12-14)13(15-4)16-10-6-2;/h5-12H2,1-4H3,(H,15,16);1H |
| InChIKey | UREDHPJBBJVOHA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|