C24H37NO5SSi — CID 10950935
methyl (3aR,7aR)-6-[tert-butyl(dimethyl)silyl]oxy-4-methyl-2-(4-methylphenyl)sulfonyl-1,3,3a,4,5,7a-hexahydroisoindole-5-carboxylate (PubChem CID 10950935) has the molecular formula C24H37NO5SSi and a molecular weight of 479.72 g/mol. Its IUPAC name is methyl (3aR,7aR)-6-[tert-butyl(dimethyl)silyl]oxy-4-methyl-2-(4-methylphenyl)sulfonyl-1,3,3a,4,5,7a-hexahydroisoindole-5-carboxylate.
| Compound Name | methyl (3aR,7aR)-6-[tert-butyl(dimethyl)silyl]oxy-4-methyl-2-(4-methylphenyl)sulfonyl-1,3,3a,4,5,7a-hexahydroisoindole-5-carboxylate |
|---|---|
| PubChem CID | 10950935 |
| Molecular Formula | C24H37NO5SSi |
| Molecular Weight | 479.72 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | methyl (3aR,7aR)-6-[tert-butyl(dimethyl)silyl]oxy-4-methyl-2-(4-methylphenyl)sulfonyl-1,3,3a,4,5,7a-hexahydroisoindole-5-carboxylate |
| SMILES | COC(=O)C1C(O[Si](C)(C)C(C)(C)C)=C[C@@H]2CN(S(=O)(=O)c3ccc(C)cc3)C[C@@H]2C1C |
| InChI | InChI=1S/C24H37NO5SSi/c1-16-9-11-19(12-10-16)31(27,28)25-14-18-13-21(30-32(7,8)24(3,4)5)22(23(26)29-6)17(2)20(18)15-25/h9-13,17-18,20,22H,14-15H2,1-8H3/t17?,18-,20-,22?/m1/s1 |
| InChIKey | ZFPMMWNCDHDSHW-UZGQDQSDSA-N |
| XLogP | 4.58 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.72 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|