C18H19N3O2S — CID 50900339
(3aS,4R,5S,7aS)-4-methyl-2-(4-methylphenyl)sulfonyl-1,3,3a,4,5,7a-hexahydroisoindole-5,6-dicarbonitrile (PubChem CID 50900339) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is (3aS,4R,5S,7aS)-4-methyl-2-(4-methylphenyl)sulfonyl-1,3,3a,4,5,7a-hexahydroisoindole-5,6-dicarbonitrile.
| Compound Name | (3aS,4R,5S,7aS)-4-methyl-2-(4-methylphenyl)sulfonyl-1,3,3a,4,5,7a-hexahydroisoindole-5,6-dicarbonitrile |
|---|---|
| PubChem CID | 50900339 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | (3aS,4R,5S,7aS)-4-methyl-2-(4-methylphenyl)sulfonyl-1,3,3a,4,5,7a-hexahydroisoindole-5,6-dicarbonitrile |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H]3[C@@H](C)[C@H](C#N)C(C#N)=C[C@@H]3C2)cc1 |
| InChI | InChI=1S/C18H19N3O2S/c1-12-3-5-16(6-4-12)24(22,23)21-10-15-7-14(8-19)17(9-20)13(2)18(15)11-21/h3-7,13,15,17-18H,10-11H2,1-2H3/t13-,15+,17-,18-/m0/s1 |
| InChIKey | XAPBMVZLHNQWEV-DHXZDTOLSA-N |
| XLogP | 2.47 |
| TPSA | 84.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |