C33H54N2O4Si — CID 10951941
benzyl (3aR,4S,7R,7aR)-4-[2-(dimethylamino)-2-oxoethyl]-7-[4-tri(propan-2-yl)silyloxybutyl]-2,3,3a,4,7,7a-hexahydroindole-1-carboxylate (PubChem CID 10951941) has the molecular formula C33H54N2O4Si and a molecular weight of 570.89 g/mol. Its IUPAC name is benzyl (3aR,4S,7R,7aR)-4-[2-(dimethylamino)-2-oxoethyl]-7-[4-tri(propan-2-yl)silyloxybutyl]-2,3,3a,4,7,7a-hexahydroindole-1-carboxylate.
| Compound Name | benzyl (3aR,4S,7R,7aR)-4-[2-(dimethylamino)-2-oxoethyl]-7-[4-tri(propan-2-yl)silyloxybutyl]-2,3,3a,4,7,7a-hexahydroindole-1-carboxylate |
|---|---|
| PubChem CID | 10951941 |
| Molecular Formula | C33H54N2O4Si |
| Molecular Weight | 570.89 g/mol |
| Exact Mass | 570.39 |
| IUPAC Name | benzyl (3aR,4S,7R,7aR)-4-[2-(dimethylamino)-2-oxoethyl]-7-[4-tri(propan-2-yl)silyloxybutyl]-2,3,3a,4,7,7a-hexahydroindole-1-carboxylate |
| SMILES | CC(C)[Si](OCCCC[C@@H]1C=C[C@H](CC(=O)N(C)C)[C@H]2CCN(C(=O)OCc3ccccc3)[C@@H]21)(C(C)C)C(C)C |
| InChI | InChI=1S/C33H54N2O4Si/c1-24(2)40(25(3)4,26(5)6)39-21-13-12-16-28-17-18-29(22-31(36)34(7)8)30-19-20-35(32(28)30)33(37)38-23-27-14-10-9-11-15-27/h9-11,14-15,17-18,24-26,28-30,32H,12-13,16,19-23H2,1-8H3/t28-,29-,30-,32-/m1/s1 |
| InChIKey | BIPXBALQAGSHSZ-PBAMLIMUSA-N |
| XLogP | 7.66 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.89 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|