C38H68N2O5Si — CID 10952457
(E,4R,6S)-4-[(11S)-11-[tert-butyl(dimethyl)silyl]oxydodecyl]-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-2,2-dimethyl-6-(phenylmethoxymethyl)-1,3-dioxan-5-imine (PubChem CID 10952457) has the molecular formula C38H68N2O5Si and a molecular weight of 661.06 g/mol. Its IUPAC name is (E,4R,6S)-4-[(11S)-11-[tert-butyl(dimethyl)silyl]oxydodecyl]-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-2,2-dimethyl-6-(phenylmethoxymethyl)-1,3-dioxan-5-imine.
| Compound Name | (E,4R,6S)-4-[(11S)-11-[tert-butyl(dimethyl)silyl]oxydodecyl]-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-2,2-dimethyl-6-(phenylmethoxymethyl)-1,3-dioxan-5-imine |
|---|---|
| PubChem CID | 10952457 |
| Molecular Formula | C38H68N2O5Si |
| Molecular Weight | 661.06 g/mol |
| Exact Mass | 660.49 |
| IUPAC Name | (E,4R,6S)-4-[(11S)-11-[tert-butyl(dimethyl)silyl]oxydodecyl]-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-2,2-dimethyl-6-(phenylmethoxymethyl)-1,3-dioxan-5-imine |
| SMILES | COC[C@H]1CCCN1/N=C1\[C@@H](CCCCCCCCCC[C@H](C)O[Si](C)(C)C(C)(C)C)OC(C)(C)O[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C38H68N2O5Si/c1-31(45-46(8,9)37(2,3)4)22-17-14-12-10-11-13-15-20-26-34-36(39-40-27-21-25-33(40)29-41-7)35(44-38(5,6)43-34)30-42-28-32-23-18-16-19-24-32/h16,18-19,23-24,31,33-35H,10-15,17,20-22,25-30H2,1-9H3/b39-36+/t31-,33+,34+,35+/m0/s1 |
| InChIKey | UYHABFCHSMUMSF-NXHGIXNUSA-N |
| XLogP | 9.50 |
| TPSA | 61.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.06 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|