C17H24N2O3 — CID 10979629
(E,2S,4R)-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-4-methyl-2-phenyl-1,3-dioxan-5-imine (PubChem CID 10979629) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is (E,2S,4R)-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-4-methyl-2-phenyl-1,3-dioxan-5-imine.
| Compound Name | (E,2S,4R)-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-4-methyl-2-phenyl-1,3-dioxan-5-imine |
|---|---|
| PubChem CID | 10979629 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | (E,2S,4R)-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-4-methyl-2-phenyl-1,3-dioxan-5-imine |
| SMILES | COC[C@H]1CCCN1/N=C1\CO[C@H](c2ccccc2)O[C@@H]1C |
| InChI | InChI=1S/C17H24N2O3/c1-13-16(18-19-10-6-9-15(19)11-20-2)12-21-17(22-13)14-7-4-3-5-8-14/h3-5,7-8,13,15,17H,6,9-12H2,1-2H3/b18-16+/t13-,15-,17+/m1/s1 |
| InChIKey | YVRVTRMNXCLHMA-YXUIKAMXSA-N |
| XLogP | 2.59 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|