C20H28N2O3 — CID 11024393
(E,2S,4R,6R)-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-4-methyl-2-phenyl-6-prop-2-enyl-1,3-dioxan-5-imine (PubChem CID 11024393) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is (E,2S,4R,6R)-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-4-methyl-2-phenyl-6-prop-2-enyl-1,3-dioxan-5-imine.
| Compound Name | (E,2S,4R,6R)-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-4-methyl-2-phenyl-6-prop-2-enyl-1,3-dioxan-5-imine |
|---|---|
| PubChem CID | 11024393 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | (E,2S,4R,6R)-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-4-methyl-2-phenyl-6-prop-2-enyl-1,3-dioxan-5-imine |
| SMILES | C=CC[C@H]1O[C@@H](c2ccccc2)O[C@H](C)/C1=N\N1CCC[C@@H]1COC |
| InChI | InChI=1S/C20H28N2O3/c1-4-9-18-19(21-22-13-8-12-17(22)14-23-3)15(2)24-20(25-18)16-10-6-5-7-11-16/h4-7,10-11,15,17-18,20H,1,8-9,12-14H2,2-3H3/b21-19+/t15-,17-,18-,20+/m1/s1 |
| InChIKey | AHXIOVVLTDPTQY-NUZFLCLASA-N |
| XLogP | 3.53 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|