About 2-methylprop-1-enyl 2-methyl-3-oxopentanoate
2-methylprop-1-enyl 2-methyl-3-oxopentanoate (PubChem CID 10954206) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is 2-methylprop-1-enyl 2-methyl-3-oxopentanoate.
Molecular Properties
| Compound Name | 2-methylprop-1-enyl 2-methyl-3-oxopentanoate |
| PubChem CID | 10954206 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 2-methylprop-1-enyl 2-methyl-3-oxopentanoate |
| SMILES | CCC(=O)C(C)C(=O)OC=C(C)C |
| InChI | InChI=1S/C10H16O3/c1-5-9(11)8(4)10(12)13-6-7(2)3/h6,8H,5H2,1-4H3 |
| InChIKey | SQALKBTUAUORDV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-1-enyl 2-methyl-3-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-1-enyl 2-methyl-3-oxopentanoate?
The IUPAC name of 2-methylprop-1-enyl 2-methyl-3-oxopentanoate (CID 10954206) is 2-methylprop-1-enyl 2-methyl-3-oxopentanoate.
What is the SMILES notation for 2-methylprop-1-enyl 2-methyl-3-oxopentanoate?
The canonical SMILES for 2-methylprop-1-enyl 2-methyl-3-oxopentanoate is CCC(=O)C(C)C(=O)OC=C(C)C.
What is the InChIKey of 2-methylprop-1-enyl 2-methyl-3-oxopentanoate?
The InChIKey is SQALKBTUAUORDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3/c1-5-9(11)8(4)10(12)13-6-7(2)3/h6,8H,5H2,1-4H3.
What are the key properties of 2-methylprop-1-enyl 2-methyl-3-oxopentanoate?
2-methylprop-1-enyl 2-methyl-3-oxopentanoate has a molecular weight of 184.23 g/mol, XLogP of 2.07, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-1-enyl 2-methyl-3-oxopentanoate is sourced from PubChem (CID 10954206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).