C10H19F2NO3 — CID 10955643
2,2-difluoro-N,N-bis(2-methoxyethyl)butanamide (PubChem CID 10955643) has the molecular formula C10H19F2NO3 and a molecular weight of 239.26 g/mol. Its IUPAC name is 2,2-difluoro-N,N-bis(2-methoxyethyl)butanamide.
| Compound Name | 2,2-difluoro-N,N-bis(2-methoxyethyl)butanamide |
|---|---|
| PubChem CID | 10955643 |
| Molecular Formula | C10H19F2NO3 |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 2,2-difluoro-N,N-bis(2-methoxyethyl)butanamide |
| SMILES | CCC(F)(F)C(=O)N(CCOC)CCOC |
| InChI | InChI=1S/C10H19F2NO3/c1-4-10(11,12)9(14)13(5-7-15-2)6-8-16-3/h4-8H2,1-3H3 |
| InChIKey | GDNHPZHPEWUCLH-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |