C17H21NO2 — CID 10956622
4-[(6aS,9R,10aR)-6a,9,10,10a-tetrahydro-6H-benzo[c]chromen-9-yl]morpholine (PubChem CID 10956622) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 4-[(6aS,9R,10aR)-6a,9,10,10a-tetrahydro-6H-benzo[c]chromen-9-yl]morpholine.
| Compound Name | 4-[(6aS,9R,10aR)-6a,9,10,10a-tetrahydro-6H-benzo[c]chromen-9-yl]morpholine |
|---|---|
| PubChem CID | 10956622 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 4-[(6aS,9R,10aR)-6a,9,10,10a-tetrahydro-6H-benzo[c]chromen-9-yl]morpholine |
| SMILES | C1=C[C@H](N2CCOCC2)C[C@H]2c3ccccc3OC[C@@H]12 |
| InChI | InChI=1S/C17H21NO2/c1-2-4-17-15(3-1)16-11-14(6-5-13(16)12-20-17)18-7-9-19-10-8-18/h1-6,13-14,16H,7-12H2/t13-,14+,16-/m1/s1 |
| InChIKey | ABRCQXJLWNUUGL-IJEWVQPXSA-N |
| XLogP | 2.44 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|