About (3S)-3-morpholin-4-yl-2,3-dihydro-1-benzothiophene 1,1-dioxide
(3S)-3-morpholin-4-yl-2,3-dihydro-1-benzothiophene 1,1-dioxide (PubChem CID 744322) has the molecular formula C12H15NO3S
and a molecular weight of 253.32 g/mol. Its IUPAC name is (3S)-3-morpholin-4-yl-2,3-dihydro-1-benzothiophene 1,1-dioxide.
Analyze (3S)-3-morpholin-4-yl-2,3-dihydro-1-benzothiophene 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-morpholin-4-yl-2,3-dihydro-1-benzothiophene 1,1-dioxide?
The IUPAC name of (3S)-3-morpholin-4-yl-2,3-dihydro-1-benzothiophene 1,1-dioxide (CID 744322) is (3S)-3-morpholin-4-yl-2,3-dihydro-1-benzothiophene 1,1-dioxide.
What is the SMILES notation for (3S)-3-morpholin-4-yl-2,3-dihydro-1-benzothiophene 1,1-dioxide?
The canonical SMILES for (3S)-3-morpholin-4-yl-2,3-dihydro-1-benzothiophene 1,1-dioxide is O=S1(=O)C[C@@H](N2CCOCC2)c2ccccc21.
What is the InChIKey of (3S)-3-morpholin-4-yl-2,3-dihydro-1-benzothiophene 1,1-dioxide?
The InChIKey is GGAKYZFQZFWTLL-LLVKDONJSA-N. The full InChI is InChI=1S/C12H15NO3S/c14-17(15)9-11(13-5-7-16-8-6-13)10-3-1-2-4-12(10)17/h1-4,11H,5-9H2/t11-/m1/s1.
What are the key properties of (3S)-3-morpholin-4-yl-2,3-dihydro-1-benzothiophene 1,1-dioxide?
(3S)-3-morpholin-4-yl-2,3-dihydro-1-benzothiophene 1,1-dioxide has a molecular weight of 253.32 g/mol, XLogP of 0.85, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-morpholin-4-yl-2,3-dihydro-1-benzothiophene 1,1-dioxide is sourced from PubChem (CID 744322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).