C17H34OSi2 — CID 10957889
2,6-dimethyl-6-trimethylsilyl-4-(2-trimethylsilylethynyl)hept-2-en-4-ol (PubChem CID 10957889) has the molecular formula C17H34OSi2 and a molecular weight of 310.63 g/mol. Its IUPAC name is 2,6-dimethyl-6-trimethylsilyl-4-(2-trimethylsilylethynyl)hept-2-en-4-ol.
| Compound Name | 2,6-dimethyl-6-trimethylsilyl-4-(2-trimethylsilylethynyl)hept-2-en-4-ol |
|---|---|
| PubChem CID | 10957889 |
| Molecular Formula | C17H34OSi2 |
| Molecular Weight | 310.63 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 2,6-dimethyl-6-trimethylsilyl-4-(2-trimethylsilylethynyl)hept-2-en-4-ol |
| SMILES | CC(C)=CC(O)(C#C[Si](C)(C)C)CC(C)(C)[Si](C)(C)C |
| InChI | InChI=1S/C17H34OSi2/c1-15(2)13-17(18,11-12-19(5,6)7)14-16(3,4)20(8,9)10/h13,18H,14H2,1-10H3 |
| InChIKey | RFPZLBXVGUWBEI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.63 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|