C19H28O11 — CID 10961008
methyl 2-methyl-2-[(2S,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]propanoate (PubChem CID 10961008) has the molecular formula C19H28O11 and a molecular weight of 432.42 g/mol. Its IUPAC name is methyl 2-methyl-2-[(2S,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]propanoate.
| Compound Name | methyl 2-methyl-2-[(2S,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]propanoate |
|---|---|
| PubChem CID | 10961008 |
| Molecular Formula | C19H28O11 |
| Molecular Weight | 432.42 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | methyl 2-methyl-2-[(2S,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]propanoate |
| SMILES | COC(=O)C(C)(C)[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H28O11/c1-9(20)26-8-13-14(27-10(2)21)15(28-11(3)22)16(29-12(4)23)17(30-13)19(5,6)18(24)25-7/h13-17H,8H2,1-7H3/t13-,14-,15+,16-,17-/m1/s1 |
| InChIKey | OIEPZWWMCDFHOV-NQNKBUKLSA-N |
| XLogP | 0.31 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.42 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|