C43H52O7SSi — CID 10963704
[(2R,3R,4R,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3-methyl-6-phenylsulfanyl-2-(trityloxymethyl)oxan-4-yl] 4-oxopentanoate (PubChem CID 10963704) has the molecular formula C43H52O7SSi and a molecular weight of 741.04 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3-methyl-6-phenylsulfanyl-2-(trityloxymethyl)oxan-4-yl] 4-oxopentanoate.
| Compound Name | [(2R,3R,4R,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3-methyl-6-phenylsulfanyl-2-(trityloxymethyl)oxan-4-yl] 4-oxopentanoate |
|---|---|
| PubChem CID | 10963704 |
| Molecular Formula | C43H52O7SSi |
| Molecular Weight | 741.04 g/mol |
| Exact Mass | 740.32 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3-methyl-6-phenylsulfanyl-2-(trityloxymethyl)oxan-4-yl] 4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](Sc2ccccc2)O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@]1(C)O |
| InChI | InChI=1S/C43H52O7SSi/c1-31(44)28-29-37(45)49-39-38(50-52(6,7)41(2,3)4)40(51-35-26-18-11-19-27-35)48-36(42(39,5)46)30-47-43(32-20-12-8-13-21-32,33-22-14-9-15-23-33)34-24-16-10-17-25-34/h8-27,36,38-40,46H,28-30H2,1-7H3/t36-,38-,39-,40+,42-/m1/s1 |
| InChIKey | SKPONLOQVJVAQO-PUFIZLONSA-N |
| XLogP | 8.93 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.04 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|