C18H36O4Si — CID 10970006
(2R,3R,4S,5R,6R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-3,5-dimethylnon-8-yne-2,6-diol (PubChem CID 10970006) has the molecular formula C18H36O4Si and a molecular weight of 344.57 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-3,5-dimethylnon-8-yne-2,6-diol.
| Compound Name | (2R,3R,4S,5R,6R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-3,5-dimethylnon-8-yne-2,6-diol |
|---|---|
| PubChem CID | 10970006 |
| Molecular Formula | C18H36O4Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (2R,3R,4S,5R,6R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-3,5-dimethylnon-8-yne-2,6-diol |
| SMILES | C#C[C@H](OC)[C@H](O)[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](C)O |
| InChI | InChI=1S/C18H36O4Si/c1-11-15(21-8)16(20)13(3)17(12(2)14(4)19)22-23(9,10)18(5,6)7/h1,12-17,19-20H,2-10H3/t12-,13-,14-,15+,16-,17+/m1/s1 |
| InChIKey | ZUCUANLUNFLKKP-IKIFYQGPSA-N |
| XLogP | 3.04 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|