C20H32O4Si — CID 10970538
[(E,1R)-1-[(2R,3R,5Z,8R)-2-ethyl-3-hydroxy-3,4,7,8-tetrahydro-2H-oxocin-8-yl]-6-trimethylsilylhex-3-en-5-ynyl] acetate (PubChem CID 10970538) has the molecular formula C20H32O4Si and a molecular weight of 364.56 g/mol. Its IUPAC name is [(E,1R)-1-[(2R,3R,5Z,8R)-2-ethyl-3-hydroxy-3,4,7,8-tetrahydro-2H-oxocin-8-yl]-6-trimethylsilylhex-3-en-5-ynyl] acetate.
| Compound Name | [(E,1R)-1-[(2R,3R,5Z,8R)-2-ethyl-3-hydroxy-3,4,7,8-tetrahydro-2H-oxocin-8-yl]-6-trimethylsilylhex-3-en-5-ynyl] acetate |
|---|---|
| PubChem CID | 10970538 |
| Molecular Formula | C20H32O4Si |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | [(E,1R)-1-[(2R,3R,5Z,8R)-2-ethyl-3-hydroxy-3,4,7,8-tetrahydro-2H-oxocin-8-yl]-6-trimethylsilylhex-3-en-5-ynyl] acetate |
| SMILES | CC[C@H]1O[C@@H]([C@@H](C/C=C/C#C[Si](C)(C)C)OC(C)=O)C/C=C\C[C@H]1O |
| InChI | InChI=1S/C20H32O4Si/c1-6-18-17(22)12-9-10-14-20(24-18)19(23-16(2)21)13-8-7-11-15-25(3,4)5/h7-10,17-20,22H,6,12-14H2,1-5H3/b8-7+,10-9-/t17-,18-,19-,20-/m1/s1 |
| InChIKey | BDOWRDCNAOJXIM-QNYFUIGPSA-N |
| XLogP | 3.62 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|