C33H62O3Si2 — CID 10951885
(E,1R)-1-[(2R,3R,5Z,8R)-2-ethyl-3-tri(propan-2-yl)silyloxy-3,4,7,8-tetrahydro-2H-oxocin-8-yl]-6-tri(propan-2-yl)silylhex-3-en-5-yn-1-ol (PubChem CID 10951885) has the molecular formula C33H62O3Si2 and a molecular weight of 563.03 g/mol. Its IUPAC name is (E,1R)-1-[(2R,3R,5Z,8R)-2-ethyl-3-tri(propan-2-yl)silyloxy-3,4,7,8-tetrahydro-2H-oxocin-8-yl]-6-tri(propan-2-yl)silylhex-3-en-5-yn-1-ol.
| Compound Name | (E,1R)-1-[(2R,3R,5Z,8R)-2-ethyl-3-tri(propan-2-yl)silyloxy-3,4,7,8-tetrahydro-2H-oxocin-8-yl]-6-tri(propan-2-yl)silylhex-3-en-5-yn-1-ol |
|---|---|
| PubChem CID | 10951885 |
| Molecular Formula | C33H62O3Si2 |
| Molecular Weight | 563.03 g/mol |
| Exact Mass | 562.42 |
| IUPAC Name | (E,1R)-1-[(2R,3R,5Z,8R)-2-ethyl-3-tri(propan-2-yl)silyloxy-3,4,7,8-tetrahydro-2H-oxocin-8-yl]-6-tri(propan-2-yl)silylhex-3-en-5-yn-1-ol |
| SMILES | CC[C@H]1O[C@@H]([C@H](O)C/C=C/C#C[Si](C(C)C)(C(C)C)C(C)C)C/C=C\C[C@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C33H62O3Si2/c1-14-31-33(36-38(27(8)9,28(10)11)29(12)13)22-18-17-21-32(35-31)30(34)20-16-15-19-23-37(24(2)3,25(4)5)26(6)7/h15-18,24-34H,14,20-22H2,1-13H3/b16-15+,18-17-/t30-,31-,32-,33-/m1/s1 |
| InChIKey | UYWRIFZMXXYJNY-TWDTZWHQSA-N |
| XLogP | 9.59 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.03 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|