C18H36O4Si — CID 11035352
(2R,3S,5Z,8S)-2-(hydroxymethyl)-8-[tri(propan-2-yl)silyloxymethyl]-3,4,7,8-tetrahydro-2H-oxocin-3-ol (PubChem CID 11035352) has the molecular formula C18H36O4Si and a molecular weight of 344.57 g/mol. Its IUPAC name is (2R,3S,5Z,8S)-2-(hydroxymethyl)-8-[tri(propan-2-yl)silyloxymethyl]-3,4,7,8-tetrahydro-2H-oxocin-3-ol.
| Compound Name | (2R,3S,5Z,8S)-2-(hydroxymethyl)-8-[tri(propan-2-yl)silyloxymethyl]-3,4,7,8-tetrahydro-2H-oxocin-3-ol |
|---|---|
| PubChem CID | 11035352 |
| Molecular Formula | C18H36O4Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (2R,3S,5Z,8S)-2-(hydroxymethyl)-8-[tri(propan-2-yl)silyloxymethyl]-3,4,7,8-tetrahydro-2H-oxocin-3-ol |
| SMILES | CC(C)[Si](OC[C@@H]1C/C=C\C[C@H](O)[C@@H](CO)O1)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H36O4Si/c1-13(2)23(14(3)4,15(5)6)21-12-16-9-7-8-10-17(20)18(11-19)22-16/h7-8,13-20H,9-12H2,1-6H3/b8-7-/t16-,17-,18+/m0/s1 |
| InChIKey | UVRPQNHQZATNQT-FGEOIHJMSA-N |
| XLogP | 3.64 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|