C18H36O3Si — CID 10947449
3-[(2R,3R,5Z,8S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-3,4,7,8-tetrahydro-2H-oxocin-8-yl]propan-1-ol (PubChem CID 10947449) has the molecular formula C18H36O3Si and a molecular weight of 328.57 g/mol. Its IUPAC name is 3-[(2R,3R,5Z,8S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-3,4,7,8-tetrahydro-2H-oxocin-8-yl]propan-1-ol.
| Compound Name | 3-[(2R,3R,5Z,8S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-3,4,7,8-tetrahydro-2H-oxocin-8-yl]propan-1-ol |
|---|---|
| PubChem CID | 10947449 |
| Molecular Formula | C18H36O3Si |
| Molecular Weight | 328.57 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | 3-[(2R,3R,5Z,8S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-3,4,7,8-tetrahydro-2H-oxocin-8-yl]propan-1-ol |
| SMILES | CC[C@H]1O[C@@H](CCCO)C/C=C\C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O3Si/c1-7-16-17(21-22(5,6)18(2,3)4)13-9-8-11-15(20-16)12-10-14-19/h8-9,15-17,19H,7,10-14H2,1-6H3/b9-8-/t15-,16-,17-/m1/s1 |
| InChIKey | XUEYSHHFVUARIY-APBGNUCKSA-N |
| XLogP | 4.66 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|