C30H56O3Si2 — CID 11103330
(E,1R)-1-[(2R,3R,5Z,8R)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-3,4,7,8-tetrahydro-2H-oxocin-8-yl]-6-tri(propan-2-yl)silylhex-3-en-5-yn-1-ol (PubChem CID 11103330) has the molecular formula C30H56O3Si2 and a molecular weight of 520.95 g/mol. Its IUPAC name is (E,1R)-1-[(2R,3R,5Z,8R)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-3,4,7,8-tetrahydro-2H-oxocin-8-yl]-6-tri(propan-2-yl)silylhex-3-en-5-yn-1-ol.
| Compound Name | (E,1R)-1-[(2R,3R,5Z,8R)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-3,4,7,8-tetrahydro-2H-oxocin-8-yl]-6-tri(propan-2-yl)silylhex-3-en-5-yn-1-ol |
|---|---|
| PubChem CID | 11103330 |
| Molecular Formula | C30H56O3Si2 |
| Molecular Weight | 520.95 g/mol |
| Exact Mass | 520.38 |
| IUPAC Name | (E,1R)-1-[(2R,3R,5Z,8R)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-3,4,7,8-tetrahydro-2H-oxocin-8-yl]-6-tri(propan-2-yl)silylhex-3-en-5-yn-1-ol |
| SMILES | CC[C@H]1O[C@@H]([C@H](O)C/C=C/C#C[Si](C(C)C)(C(C)C)C(C)C)C/C=C\C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H56O3Si2/c1-13-27-29(33-34(11,12)30(8,9)10)21-17-16-20-28(32-27)26(31)19-15-14-18-22-35(23(2)3,24(4)5)25(6)7/h14-17,23-29,31H,13,19-21H2,1-12H3/b15-14+,17-16-/t26-,27-,28-,29-/m1/s1 |
| InChIKey | JQYSPUBTXAIIBD-SOFYIKCZSA-N |
| XLogP | 8.42 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.95 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|