C22H38O3SSi — CID 10971628
2-[(2R,4R,6S)-2-[(2R)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-6-phenylsulfanyloxan-4-yl]ethanol (PubChem CID 10971628) has the molecular formula C22H38O3SSi and a molecular weight of 410.70 g/mol. Its IUPAC name is 2-[(2R,4R,6S)-2-[(2R)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-6-phenylsulfanyloxan-4-yl]ethanol.
| Compound Name | 2-[(2R,4R,6S)-2-[(2R)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-6-phenylsulfanyloxan-4-yl]ethanol |
|---|---|
| PubChem CID | 10971628 |
| Molecular Formula | C22H38O3SSi |
| Molecular Weight | 410.70 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 2-[(2R,4R,6S)-2-[(2R)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-6-phenylsulfanyloxan-4-yl]ethanol |
| SMILES | C[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]1C[C@@H](CCO)C[C@H](Sc2ccccc2)O1 |
| InChI | InChI=1S/C22H38O3SSi/c1-17(16-24-27(5,6)22(2,3)4)20-14-18(12-13-23)15-21(25-20)26-19-10-8-7-9-11-19/h7-11,17-18,20-21,23H,12-16H2,1-6H3/t17-,18-,20-,21+/m1/s1 |
| InChIKey | ZOEFEWOBJILDKO-UKAVVXHISA-N |
| XLogP | 5.94 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.70 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|